C8H13N3S — CID 72942833
N-methyl-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazol-2-amine (PubChem CID 72942833) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is N-methyl-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazol-2-amine.
| Compound Name | N-methyl-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 72942833 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | N-methyl-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazol-2-amine |
| SMILES | CNc1nc([C@@H]2CCCN2)cs1 |
| InChI | InChI=1S/C8H13N3S/c1-9-8-11-7(5-12-8)6-3-2-4-10-6/h5-6,10H,2-4H2,1H3,(H,9,11)/t6-/m0/s1 |
| InChIKey | OVWHHUPRVQIRGU-LURJTMIESA-N |
| XLogP | 1.61 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |