C21H23N5O3S — CID 87380596
N-benzyl-2-[[N'-[(2,6-dimethoxyphenyl)methyl]carbamimidoyl]amino]-1,3-thiazole-4-carboxamide (PubChem CID 87380596) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-benzyl-2-[[N'-[(2,6-dimethoxyphenyl)methyl]carbamimidoyl]amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-benzyl-2-[[N'-[(2,6-dimethoxyphenyl)methyl]carbamimidoyl]amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 87380596 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-benzyl-2-[[N'-[(2,6-dimethoxyphenyl)methyl]carbamimidoyl]amino]-1,3-thiazole-4-carboxamide |
| SMILES | COc1cccc(OC)c1C/N=C(\N)Nc1nc(C(=O)NCc2ccccc2)cs1 |
| InChI | InChI=1S/C21H23N5O3S/c1-28-17-9-6-10-18(29-2)15(17)12-24-20(22)26-21-25-16(13-30-21)19(27)23-11-14-7-4-3-5-8-14/h3-10,13H,11-12H2,1-2H3,(H,23,27)(H3,22,24,25,26) |
| InChIKey | DGSISRPKCNHZGS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|