C12H12N4O2S — CID 11173441
2-[(N'-benzylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 11173441) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-[(N'-benzylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(N'-benzylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 11173441 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-[(N'-benzylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | N/C(=N\Cc1ccccc1)Nc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C12H12N4O2S/c13-11(14-6-8-4-2-1-3-5-8)16-12-15-9(7-19-12)10(17)18/h1-5,7H,6H2,(H,17,18)(H3,13,14,15,16) |
| InChIKey | DRYXAGUXNWTVKE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|