C5H5N3O4S — CID 175331559
2-(hydroxycarbamoylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 175331559) has the molecular formula C5H5N3O4S and a molecular weight of 203.18 g/mol. Its IUPAC name is 2-(hydroxycarbamoylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(hydroxycarbamoylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 175331559 |
| Molecular Formula | C5H5N3O4S |
| Molecular Weight | 203.18 g/mol |
| Exact Mass | 203.00 |
| IUPAC Name | 2-(hydroxycarbamoylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(NO)Nc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C5H5N3O4S/c9-3(10)2-1-13-5(6-2)7-4(11)8-12/h1,12H,(H,9,10)(H2,6,7,8,11) |
| InChIKey | WBJUXJNZKLBUDR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.18 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|