About 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid
2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 139707658) has the molecular formula C9H14N4O2S
and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 139707658 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCC/N=C(\N)Nc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C9H14N4O2S/c1-2-3-4-11-8(10)13-9-12-6(5-16-9)7(14)15/h5H,2-4H2,1H3,(H,14,15)(H3,10,11,12,13) |
| InChIKey | MDKCRVOMQHMCCH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid (CID 139707658) is 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid is CCCC/N=C(\N)Nc1nc(C(=O)O)cs1.
What is the InChIKey of 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid?
The InChIKey is MDKCRVOMQHMCCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2S/c1-2-3-4-11-8(10)13-9-12-6(5-16-9)7(14)15/h5H,2-4H2,1H3,(H,14,15)(H3,10,11,12,13).
What are the key properties of 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid?
2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid has a molecular weight of 242.30 g/mol, XLogP of 1.37, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 139707658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).