C9H15N3OS — CID 69456979
2-(pentylamino)-1,3-thiazole-4-carboxamide (PubChem CID 69456979) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-(pentylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(pentylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 69456979 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-(pentylamino)-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCNc1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C9H15N3OS/c1-2-3-4-5-11-9-12-7(6-14-9)8(10)13/h6H,2-5H2,1H3,(H2,10,13)(H,11,12) |
| InChIKey | PXFGIWCRDHVNEQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|