C14H21N3O3S — CID 42813693
1-[2-(butylamino)-1,3-thiazole-4-carbonyl]piperidine-2-carboxylic acid (PubChem CID 42813693) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-[2-(butylamino)-1,3-thiazole-4-carbonyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-(butylamino)-1,3-thiazole-4-carbonyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 42813693 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-[2-(butylamino)-1,3-thiazole-4-carbonyl]piperidine-2-carboxylic acid |
| SMILES | CCCCNc1nc(C(=O)N2CCCCC2C(=O)O)cs1 |
| InChI | InChI=1S/C14H21N3O3S/c1-2-3-7-15-14-16-10(9-21-14)12(18)17-8-5-4-6-11(17)13(19)20/h9,11H,2-8H2,1H3,(H,15,16)(H,19,20) |
| InChIKey | SXZCUZUAUIJJTK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|