C20H27N5O2S — CID 42813442
1-[2-(butylamino)-1,3-thiazole-4-carbonyl]-N-(pyridin-3-ylmethyl)piperidine-2-carboxamide (PubChem CID 42813442) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is 1-[2-(butylamino)-1,3-thiazole-4-carbonyl]-N-(pyridin-3-ylmethyl)piperidine-2-carboxamide.
| Compound Name | 1-[2-(butylamino)-1,3-thiazole-4-carbonyl]-N-(pyridin-3-ylmethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 42813442 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-[2-(butylamino)-1,3-thiazole-4-carbonyl]-N-(pyridin-3-ylmethyl)piperidine-2-carboxamide |
| SMILES | CCCCNc1nc(C(=O)N2CCCCC2C(=O)NCc2cccnc2)cs1 |
| InChI | InChI=1S/C20H27N5O2S/c1-2-3-10-22-20-24-16(14-28-20)19(27)25-11-5-4-8-17(25)18(26)23-13-15-7-6-9-21-12-15/h6-7,9,12,14,17H,2-5,8,10-11,13H2,1H3,(H,22,24)(H,23,26) |
| InChIKey | SBKKXEKMRVZXGR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|