C20H26N4O4S — CID 93305293
(2S)-1-[2-(3-methoxyanilino)-1,3-thiazole-4-carbonyl]-N-(2-methoxyethyl)piperidine-2-carboxamide (PubChem CID 93305293) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is (2S)-1-[2-(3-methoxyanilino)-1,3-thiazole-4-carbonyl]-N-(2-methoxyethyl)piperidine-2-carboxamide.
| Compound Name | (2S)-1-[2-(3-methoxyanilino)-1,3-thiazole-4-carbonyl]-N-(2-methoxyethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 93305293 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (2S)-1-[2-(3-methoxyanilino)-1,3-thiazole-4-carbonyl]-N-(2-methoxyethyl)piperidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CCCCN1C(=O)c1csc(Nc2cccc(OC)c2)n1 |
| InChI | InChI=1S/C20H26N4O4S/c1-27-11-9-21-18(25)17-8-3-4-10-24(17)19(26)16-13-29-20(23-16)22-14-6-5-7-15(12-14)28-2/h5-7,12-13,17H,3-4,8-11H2,1-2H3,(H,21,25)(H,22,23)/t17-/m0/s1 |
| InChIKey | SACXMIXRKXNBIW-KRWDZBQOSA-N |
| XLogP | 2.65 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|