C19H21F3N4O3S — CID 42813279
N-(2-methoxyethyl)-1-[2-[3-(trifluoromethyl)anilino]-1,3-thiazole-4-carbonyl]pyrrolidine-2-carboxamide (PubChem CID 42813279) has the molecular formula C19H21F3N4O3S and a molecular weight of 442.46 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-[2-[3-(trifluoromethyl)anilino]-1,3-thiazole-4-carbonyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-[2-[3-(trifluoromethyl)anilino]-1,3-thiazole-4-carbonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 42813279 |
| Molecular Formula | C19H21F3N4O3S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-(2-methoxyethyl)-1-[2-[3-(trifluoromethyl)anilino]-1,3-thiazole-4-carbonyl]pyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)C1CCCN1C(=O)c1csc(Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C19H21F3N4O3S/c1-29-9-7-23-16(27)15-6-3-8-26(15)17(28)14-11-30-18(25-14)24-13-5-2-4-12(10-13)19(20,21)22/h2,4-5,10-11,15H,3,6-9H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | PHZGXVFCGCFORJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|