C18H20Cl2N4O3S — CID 90488367
1-[2-(3,4-dichloroanilino)-1,3-thiazole-4-carbonyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide (PubChem CID 90488367) has the molecular formula C18H20Cl2N4O3S and a molecular weight of 443.36 g/mol. Its IUPAC name is 1-[2-(3,4-dichloroanilino)-1,3-thiazole-4-carbonyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(3,4-dichloroanilino)-1,3-thiazole-4-carbonyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90488367 |
| Molecular Formula | C18H20Cl2N4O3S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 1-[2-(3,4-dichloroanilino)-1,3-thiazole-4-carbonyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)C1CCCN1C(=O)c1csc(Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C18H20Cl2N4O3S/c1-27-8-6-21-16(25)15-3-2-7-24(15)17(26)14-10-28-18(23-14)22-11-4-5-12(19)13(20)9-11/h4-5,9-10,15H,2-3,6-8H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | FXRPDXDFIQWUSU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|