C22H33N3O3 — CID 59107691
1-(3,3-dimethyl-2-oxopentanoyl)-N-(4-pyridin-3-ylbutyl)piperidine-2-carboxamide (PubChem CID 59107691) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2-oxopentanoyl)-N-(4-pyridin-3-ylbutyl)piperidine-2-carboxamide.
| Compound Name | 1-(3,3-dimethyl-2-oxopentanoyl)-N-(4-pyridin-3-ylbutyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 59107691 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 1-(3,3-dimethyl-2-oxopentanoyl)-N-(4-pyridin-3-ylbutyl)piperidine-2-carboxamide |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCCC1C(=O)NCCCCc1cccnc1 |
| InChI | InChI=1S/C22H33N3O3/c1-4-22(2,3)19(26)21(28)25-15-8-6-12-18(25)20(27)24-14-7-5-10-17-11-9-13-23-16-17/h9,11,13,16,18H,4-8,10,12,14-15H2,1-3H3,(H,24,27) |
| InChIKey | AOSKFDSVVWUMLV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|