C21H30N2O7 — CID 67445521
carbonic acid;3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate (PubChem CID 67445521) has the molecular formula C21H30N2O7 and a molecular weight of 422.48 g/mol. Its IUPAC name is carbonic acid;3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate.
| Compound Name | carbonic acid;3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 67445521 |
| Molecular Formula | C21H30N2O7 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | carbonic acid;3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1C(=O)OCCCc1cccnc1.O=C(O)O |
| InChI | InChI=1S/C20H28N2O4.CH2O3/c1-4-20(2,3)17(23)18(24)22-12-6-10-16(22)19(25)26-13-7-9-15-8-5-11-21-14-15;2-1(3)4/h5,8,11,14,16H,4,6-7,9-10,12-13H2,1-3H3;(H2,2,3,4) |
| InChIKey | FOIFOEMQMRXLKV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 134.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|