C27H33NO4 — CID 58648551
[(1S)-1,3-diphenylpropyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate (PubChem CID 58648551) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is [(1S)-1,3-diphenylpropyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate.
| Compound Name | [(1S)-1,3-diphenylpropyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 58648551 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | [(1S)-1,3-diphenylpropyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCC[C@H]1C(=O)O[C@@H](CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33NO4/c1-4-27(2,3)24(29)25(30)28-19-11-16-22(28)26(31)32-23(21-14-9-6-10-15-21)18-17-20-12-7-5-8-13-20/h5-10,12-15,22-23H,4,11,16-19H2,1-3H3/t22-,23-/m0/s1 |
| InChIKey | LEJAJZFXBDSODT-GOTSBHOMSA-N |
| XLogP | 4.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|