C33H47NO6Si — CID 67575282
1,3-diphenylpropyl (2S)-1-[3,3-dimethyl-2-oxo-4-(2-trimethylsilylethoxymethoxy)butanoyl]piperidine-2-carboxylate (PubChem CID 67575282) has the molecular formula C33H47NO6Si and a molecular weight of 581.83 g/mol. Its IUPAC name is 1,3-diphenylpropyl (2S)-1-[3,3-dimethyl-2-oxo-4-(2-trimethylsilylethoxymethoxy)butanoyl]piperidine-2-carboxylate.
| Compound Name | 1,3-diphenylpropyl (2S)-1-[3,3-dimethyl-2-oxo-4-(2-trimethylsilylethoxymethoxy)butanoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 67575282 |
| Molecular Formula | C33H47NO6Si |
| Molecular Weight | 581.83 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | 1,3-diphenylpropyl (2S)-1-[3,3-dimethyl-2-oxo-4-(2-trimethylsilylethoxymethoxy)butanoyl]piperidine-2-carboxylate |
| SMILES | CC(C)(COCOCC[Si](C)(C)C)C(=O)C(=O)N1CCCC[C@H]1C(=O)OC(CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H47NO6Si/c1-33(2,24-39-25-38-22-23-41(3,4)5)30(35)31(36)34-21-13-12-18-28(34)32(37)40-29(27-16-10-7-11-17-27)20-19-26-14-8-6-9-15-26/h6-11,14-17,28-29H,12-13,18-25H2,1-5H3/t28-,29?/m0/s1 |
| InChIKey | QNIRKWGNBRFFMX-XLTVJXRZSA-N |
| XLogP | 6.21 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.83 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|