C35H41NO11 — CID 157262467
5-[3-[(1R)-3-(3,4-dihydroxyphenyl)-1-[(2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carbonyl]oxypropyl]phenyl]-4-oxopentanoic acid (PubChem CID 157262467) has the molecular formula C35H41NO11 and a molecular weight of 651.71 g/mol. Its IUPAC name is 5-[3-[(1R)-3-(3,4-dihydroxyphenyl)-1-[(2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carbonyl]oxypropyl]phenyl]-4-oxopentanoic acid.
| Compound Name | 5-[3-[(1R)-3-(3,4-dihydroxyphenyl)-1-[(2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carbonyl]oxypropyl]phenyl]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 157262467 |
| Molecular Formula | C35H41NO11 |
| Molecular Weight | 651.71 g/mol |
| Exact Mass | 651.27 |
| IUPAC Name | 5-[3-[(1R)-3-(3,4-dihydroxyphenyl)-1-[(2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carbonyl]oxypropyl]phenyl]-4-oxopentanoic acid |
| SMILES | C=CC(=O)OCC(C)(C)C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](CCc1ccc(O)c(O)c1)c1cccc(CC(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/C35H41NO11/c1-4-31(42)46-21-35(2,3)32(43)33(44)36-17-6-5-10-26(36)34(45)47-29(15-12-22-11-14-27(38)28(39)20-22)24-9-7-8-23(18-24)19-25(37)13-16-30(40)41/h4,7-9,11,14,18,20,26,29,38-39H,1,5-6,10,12-13,15-17,19,21H2,2-3H3,(H,40,41)/t26-,29+/m0/s1 |
| InChIKey | AXPRXAPWWNPIPM-LITSAYRRSA-N |
| XLogP | 4.00 |
| TPSA | 184.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.71 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|