C37H53N3O9 — CID 159012784
[(1R)-1-[3-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]phenyl]-3-piperidin-1-ylpropyl] (2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carboxylate (PubChem CID 159012784) has the molecular formula C37H53N3O9 and a molecular weight of 683.84 g/mol. Its IUPAC name is [(1R)-1-[3-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]phenyl]-3-piperidin-1-ylpropyl] (2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carboxylate.
| Compound Name | [(1R)-1-[3-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]phenyl]-3-piperidin-1-ylpropyl] (2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 159012784 |
| Molecular Formula | C37H53N3O9 |
| Molecular Weight | 683.84 g/mol |
| Exact Mass | 683.38 |
| IUPAC Name | [(1R)-1-[3-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]phenyl]-3-piperidin-1-ylpropyl] (2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carboxylate |
| SMILES | C=CC(=O)OCC(C)(C)C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](CCN1CCCCC1)c1cccc(NC(=O)CCC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C37H53N3O9/c1-7-31(42)47-25-37(5,6)33(44)34(45)40-22-12-9-16-28(40)35(46)48-29(19-23-39-20-10-8-11-21-39)26-14-13-15-27(24-26)38-30(41)17-18-32(43)49-36(2,3)4/h7,13-15,24,28-29H,1,8-12,16-23,25H2,2-6H3,(H,38,41)/t28-,29+/m0/s1 |
| InChIKey | UUBSHXATZGKUSI-URLMMPGGSA-N |
| XLogP | 4.91 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.84 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|