C35H45N3O9 — CID 146352418
[(1R)-1-[3-(butanoylamino)phenyl]-3-(3,4-dimethoxyphenyl)propyl] 1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperazine-2-carboxylate (PubChem CID 146352418) has the molecular formula C35H45N3O9 and a molecular weight of 651.76 g/mol. Its IUPAC name is [(1R)-1-[3-(butanoylamino)phenyl]-3-(3,4-dimethoxyphenyl)propyl] 1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperazine-2-carboxylate.
| Compound Name | [(1R)-1-[3-(butanoylamino)phenyl]-3-(3,4-dimethoxyphenyl)propyl] 1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 146352418 |
| Molecular Formula | C35H45N3O9 |
| Molecular Weight | 651.76 g/mol |
| Exact Mass | 651.32 |
| IUPAC Name | [(1R)-1-[3-(butanoylamino)phenyl]-3-(3,4-dimethoxyphenyl)propyl] 1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperazine-2-carboxylate |
| SMILES | C=CC(=O)OCC(C)(C)C(=O)C(=O)N1CCNCC1C(=O)O[C@H](CCc1ccc(OC)c(OC)c1)c1cccc(NC(=O)CCC)c1 |
| InChI | InChI=1S/C35H45N3O9/c1-7-10-30(39)37-25-12-9-11-24(20-25)27(15-13-23-14-16-28(44-5)29(19-23)45-6)47-34(43)26-21-36-17-18-38(26)33(42)32(41)35(3,4)22-46-31(40)8-2/h8-9,11-12,14,16,19-20,26-27,36H,2,7,10,13,15,17-18,21-22H2,1,3-6H3,(H,37,39)/t26?,27-/m1/s1 |
| InChIKey | DZKAHFSIYVQTKA-SSYAZFEXSA-N |
| XLogP | 3.78 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.76 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|