C34H42N2O11 — CID 146315590
2-[3-[(1R)-3-(3,4-dimethoxyphenyl)-1-[1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)-4-methylpiperazine-2-carbonyl]oxypropyl]phenoxy]acetic acid (PubChem CID 146315590) has the molecular formula C34H42N2O11 and a molecular weight of 654.71 g/mol. Its IUPAC name is 2-[3-[(1R)-3-(3,4-dimethoxyphenyl)-1-[1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)-4-methylpiperazine-2-carbonyl]oxypropyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(1R)-3-(3,4-dimethoxyphenyl)-1-[1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)-4-methylpiperazine-2-carbonyl]oxypropyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 146315590 |
| Molecular Formula | C34H42N2O11 |
| Molecular Weight | 654.71 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 2-[3-[(1R)-3-(3,4-dimethoxyphenyl)-1-[1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)-4-methylpiperazine-2-carbonyl]oxypropyl]phenoxy]acetic acid |
| SMILES | C=CC(=O)OCC(C)(C)C(=O)C(=O)N1CCN(C)CC1C(=O)O[C@H](CCc1ccc(OC)c(OC)c1)c1cccc(OCC(=O)O)c1 |
| InChI | InChI=1S/C34H42N2O11/c1-7-30(39)46-21-34(2,3)31(40)32(41)36-16-15-35(4)19-25(36)33(42)47-26(23-9-8-10-24(18-23)45-20-29(37)38)13-11-22-12-14-27(43-5)28(17-22)44-6/h7-10,12,14,17-18,25-26H,1,11,13,15-16,19-21H2,2-6H3,(H,37,38)/t25?,26-/m1/s1 |
| InChIKey | YLHDBDULZSNTKZ-FXDYGKIASA-N |
| XLogP | 2.85 |
| TPSA | 158.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|