C35H48N2O9 — CID 66743021
[(1R)-3-(3,4-dimethoxyphenyl)-1-[3-[2-(3-hydroxypropylamino)-2-oxoethoxy]phenyl]propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate (PubChem CID 66743021) has the molecular formula C35H48N2O9 and a molecular weight of 640.77 g/mol. Its IUPAC name is [(1R)-3-(3,4-dimethoxyphenyl)-1-[3-[2-(3-hydroxypropylamino)-2-oxoethoxy]phenyl]propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate.
| Compound Name | [(1R)-3-(3,4-dimethoxyphenyl)-1-[3-[2-(3-hydroxypropylamino)-2-oxoethoxy]phenyl]propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 66743021 |
| Molecular Formula | C35H48N2O9 |
| Molecular Weight | 640.77 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | [(1R)-3-(3,4-dimethoxyphenyl)-1-[3-[2-(3-hydroxypropylamino)-2-oxoethoxy]phenyl]propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](CCc1ccc(OC)c(OC)c1)c1cccc(OCC(=O)NCCCO)c1 |
| InChI | InChI=1S/C35H48N2O9/c1-6-35(2,3)32(40)33(41)37-19-8-7-13-27(37)34(42)46-28(16-14-24-15-17-29(43-4)30(21-24)44-5)25-11-9-12-26(22-25)45-23-31(39)36-18-10-20-38/h9,11-12,15,17,21-22,27-28,38H,6-8,10,13-14,16,18-20,23H2,1-5H3,(H,36,39)/t27-,28+/m0/s1 |
| InChIKey | XAJSLKVDBYXZGG-WUFINQPMSA-N |
| XLogP | 4.18 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|