C32H43NO6S — CID 163744706
[3-(3,4-dimethoxyphenyl)-1-[3-[(1R)-1-sulfanylethyl]phenyl]propyl] 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate (PubChem CID 163744706) has the molecular formula C32H43NO6S and a molecular weight of 569.76 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-1-[3-[(1R)-1-sulfanylethyl]phenyl]propyl] 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate.
| Compound Name | [3-(3,4-dimethoxyphenyl)-1-[3-[(1R)-1-sulfanylethyl]phenyl]propyl] 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 163744706 |
| Molecular Formula | C32H43NO6S |
| Molecular Weight | 569.76 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-1-[3-[(1R)-1-sulfanylethyl]phenyl]propyl] 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCCC1C(=O)OC(CCc1ccc(OC)c(OC)c1)c1cccc([C@@H](C)S)c1 |
| InChI | InChI=1S/C32H43NO6S/c1-7-32(3,4)29(34)30(35)33-18-9-8-13-25(33)31(36)39-26(24-12-10-11-23(20-24)21(2)40)16-14-22-15-17-27(37-5)28(19-22)38-6/h10-12,15,17,19-21,25-26,40H,7-9,13-14,16,18H2,1-6H3/t21-,25?,26?/m1/s1 |
| InChIKey | LKVBXYULQPKDHQ-ZUOMXFFYSA-N |
| XLogP | 6.30 |
| TPSA | 82.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.76 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|