C35H49N3O8 — CID 154677641
[(1R)-1-[3-[3-(2-aminoethoxy)propanoylamino]phenyl]-3-(3,4-dimethoxyphenyl)propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate (PubChem CID 154677641) has the molecular formula C35H49N3O8 and a molecular weight of 639.79 g/mol. Its IUPAC name is [(1R)-1-[3-[3-(2-aminoethoxy)propanoylamino]phenyl]-3-(3,4-dimethoxyphenyl)propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate.
| Compound Name | [(1R)-1-[3-[3-(2-aminoethoxy)propanoylamino]phenyl]-3-(3,4-dimethoxyphenyl)propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 154677641 |
| Molecular Formula | C35H49N3O8 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.35 |
| IUPAC Name | [(1R)-1-[3-[3-(2-aminoethoxy)propanoylamino]phenyl]-3-(3,4-dimethoxyphenyl)propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](CCc1ccc(OC)c(OC)c1)c1cccc(NC(=O)CCOCCN)c1 |
| InChI | InChI=1S/C35H49N3O8/c1-6-35(2,3)32(40)33(41)38-19-8-7-12-27(38)34(42)46-28(15-13-24-14-16-29(43-4)30(22-24)44-5)25-10-9-11-26(23-25)37-31(39)17-20-45-21-18-36/h9-11,14,16,22-23,27-28H,6-8,12-13,15,17-21,36H2,1-5H3,(H,37,39)/t27-,28+/m0/s1 |
| InChIKey | GDDQNLJHPCNVLV-WUFINQPMSA-N |
| XLogP | 4.61 |
| TPSA | 146.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|