C39H48N2O10 — CID 158989290
[(1R)-3-(3-methoxy-4-methylphenyl)-1-[3-[(4-oxo-4-prop-2-enoxybutanoyl)amino]phenyl]propyl] (2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carboxylate (PubChem CID 158989290) has the molecular formula C39H48N2O10 and a molecular weight of 704.82 g/mol. Its IUPAC name is [(1R)-3-(3-methoxy-4-methylphenyl)-1-[3-[(4-oxo-4-prop-2-enoxybutanoyl)amino]phenyl]propyl] (2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carboxylate.
| Compound Name | [(1R)-3-(3-methoxy-4-methylphenyl)-1-[3-[(4-oxo-4-prop-2-enoxybutanoyl)amino]phenyl]propyl] (2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 158989290 |
| Molecular Formula | C39H48N2O10 |
| Molecular Weight | 704.82 g/mol |
| Exact Mass | 704.33 |
| IUPAC Name | [(1R)-3-(3-methoxy-4-methylphenyl)-1-[3-[(4-oxo-4-prop-2-enoxybutanoyl)amino]phenyl]propyl] (2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carboxylate |
| SMILES | C=CCOC(=O)CCC(=O)Nc1cccc([C@@H](CCc2ccc(C)c(OC)c2)OC(=O)[C@@H]2CCCCN2C(=O)C(=O)C(C)(C)COC(=O)C=C)c1 |
| InChI | InChI=1S/C39H48N2O10/c1-7-22-49-35(44)20-19-33(42)40-29-13-11-12-28(24-29)31(18-17-27-16-15-26(3)32(23-27)48-6)51-38(47)30-14-9-10-21-41(30)37(46)36(45)39(4,5)25-50-34(43)8-2/h7-8,11-13,15-16,23-24,30-31H,1-2,9-10,14,17-22,25H2,3-6H3,(H,40,42)/t30-,31+/m0/s1 |
| InChIKey | GNPSEAOKLBNYMP-IOWSJCHKSA-N |
| XLogP | 5.37 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.82 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|