C38H49NO10 — CID 158132980
[(1R)-3-(3-methoxy-4-methylphenyl)-1-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]propyl] (2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carboxylate (PubChem CID 158132980) has the molecular formula C38H49NO10 and a molecular weight of 679.81 g/mol. Its IUPAC name is [(1R)-3-(3-methoxy-4-methylphenyl)-1-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]propyl] (2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carboxylate.
| Compound Name | [(1R)-3-(3-methoxy-4-methylphenyl)-1-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]propyl] (2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 158132980 |
| Molecular Formula | C38H49NO10 |
| Molecular Weight | 679.81 g/mol |
| Exact Mass | 679.34 |
| IUPAC Name | [(1R)-3-(3-methoxy-4-methylphenyl)-1-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]propyl] (2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carboxylate |
| SMILES | C=CC(=O)OCC(C)(C)C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](CCc1ccc(C)c(OC)c1)c1cccc(OCC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C38H49NO10/c1-9-32(40)47-24-38(6,7)34(42)35(43)39-20-11-10-15-29(39)36(44)48-30(19-18-26-17-16-25(2)31(21-26)45-8)27-13-12-14-28(22-27)46-23-33(41)49-37(3,4)5/h9,12-14,16-17,21-22,29-30H,1,10-11,15,18-20,23-24H2,2-8H3/t29-,30+/m0/s1 |
| InChIKey | UUJWQGXZFKALAT-XZWHSSHBSA-N |
| XLogP | 5.65 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.81 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|