C33H39NO10 — CID 146352436
2-[3-[(1R)-1-[(2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carbonyl]oxy-3-(3-methoxyphenyl)propyl]phenoxy]acetic acid (PubChem CID 146352436) has the molecular formula C33H39NO10 and a molecular weight of 609.67 g/mol. Its IUPAC name is 2-[3-[(1R)-1-[(2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carbonyl]oxy-3-(3-methoxyphenyl)propyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(1R)-1-[(2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carbonyl]oxy-3-(3-methoxyphenyl)propyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 146352436 |
| Molecular Formula | C33H39NO10 |
| Molecular Weight | 609.67 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | 2-[3-[(1R)-1-[(2S)-1-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)piperidine-2-carbonyl]oxy-3-(3-methoxyphenyl)propyl]phenoxy]acetic acid |
| SMILES | C=CC(=O)OCC(C)(C)C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](CCc1cccc(OC)c1)c1cccc(OCC(=O)O)c1 |
| InChI | InChI=1S/C33H39NO10/c1-5-29(37)43-21-33(2,3)30(38)31(39)34-17-7-6-14-26(34)32(40)44-27(16-15-22-10-8-12-24(18-22)41-4)23-11-9-13-25(19-23)42-20-28(35)36/h5,8-13,18-19,26-27H,1,6-7,14-17,20-21H2,2-4H3,(H,35,36)/t26-,27+/m0/s1 |
| InChIKey | DUIQHGHJTYAISG-RRPNLBNLSA-N |
| XLogP | 4.08 |
| TPSA | 145.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|