C31H39NO7 — CID 162671100
[(1R)-3-(3,4-dimethoxyphenyl)-1-phenylpropyl] (2S)-1-(2,2-dimethyl-3-prop-2-enoyloxypropanoyl)piperidine-2-carboxylate (PubChem CID 162671100) has the molecular formula C31H39NO7 and a molecular weight of 537.65 g/mol. Its IUPAC name is [(1R)-3-(3,4-dimethoxyphenyl)-1-phenylpropyl] (2S)-1-(2,2-dimethyl-3-prop-2-enoyloxypropanoyl)piperidine-2-carboxylate.
| Compound Name | [(1R)-3-(3,4-dimethoxyphenyl)-1-phenylpropyl] (2S)-1-(2,2-dimethyl-3-prop-2-enoyloxypropanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 162671100 |
| Molecular Formula | C31H39NO7 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | [(1R)-3-(3,4-dimethoxyphenyl)-1-phenylpropyl] (2S)-1-(2,2-dimethyl-3-prop-2-enoyloxypropanoyl)piperidine-2-carboxylate |
| SMILES | C=CC(=O)OCC(C)(C)C(=O)N1CCCC[C@H]1C(=O)O[C@H](CCc1ccc(OC)c(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C31H39NO7/c1-6-28(33)38-21-31(2,3)30(35)32-19-11-10-14-24(32)29(34)39-25(23-12-8-7-9-13-23)17-15-22-16-18-26(36-4)27(20-22)37-5/h6-9,12-13,16,18,20,24-25H,1,10-11,14-15,17,19,21H2,2-5H3/t24-,25+/m0/s1 |
| InChIKey | OJGSIBJYYNFYNB-LOSJGSFVSA-N |
| XLogP | 5.06 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|