C35H43N3O12 — CID 146352470
(3S)-4-[3-[(1R)-3-(3,4-dimethoxyphenyl)-1-[2-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)diazinane-1-carbonyl]oxypropyl]anilino]-3-hydroxy-4-oxobutanoic acid (PubChem CID 146352470) has the molecular formula C35H43N3O12 and a molecular weight of 697.74 g/mol. Its IUPAC name is (3S)-4-[3-[(1R)-3-(3,4-dimethoxyphenyl)-1-[2-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)diazinane-1-carbonyl]oxypropyl]anilino]-3-hydroxy-4-oxobutanoic acid.
| Compound Name | (3S)-4-[3-[(1R)-3-(3,4-dimethoxyphenyl)-1-[2-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)diazinane-1-carbonyl]oxypropyl]anilino]-3-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 146352470 |
| Molecular Formula | C35H43N3O12 |
| Molecular Weight | 697.74 g/mol |
| Exact Mass | 697.28 |
| IUPAC Name | (3S)-4-[3-[(1R)-3-(3,4-dimethoxyphenyl)-1-[2-(3,3-dimethyl-2-oxo-4-prop-2-enoyloxybutanoyl)diazinane-1-carbonyl]oxypropyl]anilino]-3-hydroxy-4-oxobutanoic acid |
| SMILES | C=CC(=O)OCC(C)(C)C(=O)C(=O)N1CCCCN1C(=O)O[C@H](CCc1ccc(OC)c(OC)c1)c1cccc(NC(=O)[C@@H](O)CC(=O)O)c1 |
| InChI | InChI=1S/C35H43N3O12/c1-6-30(42)49-21-35(2,3)31(43)33(45)37-16-7-8-17-38(37)34(46)50-26(14-12-22-13-15-27(47-4)28(18-22)48-5)23-10-9-11-24(19-23)36-32(44)25(39)20-29(40)41/h6,9-11,13,15,18-19,25-26,39H,1,7-8,12,14,16-17,20-21H2,2-5H3,(H,36,44)(H,40,41)/t25-,26+/m0/s1 |
| InChIKey | IJQACXQATMVZQR-IZZNHLLZSA-N |
| XLogP | 3.45 |
| TPSA | 198.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|