C31H41NO4 — CID 21027760
1,7-diphenylheptan-4-yl 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate (PubChem CID 21027760) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is 1,7-diphenylheptan-4-yl 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate.
| Compound Name | 1,7-diphenylheptan-4-yl 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 21027760 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | 1,7-diphenylheptan-4-yl 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1C(=O)OC(CCCc1ccccc1)CCCc1ccccc1 |
| InChI | InChI=1S/C31H41NO4/c1-4-31(2,3)28(33)29(34)32-23-13-22-27(32)30(35)36-26(20-11-18-24-14-7-5-8-15-24)21-12-19-25-16-9-6-10-17-25/h5-10,14-17,26-27H,4,11-13,18-23H2,1-3H3 |
| InChIKey | NEKUVXITEQALOV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|