C20H29N2O5+ — CID 142038688
3-(1-hydroxypyridin-1-ium-3-yl)propyl 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate (PubChem CID 142038688) has the molecular formula C20H29N2O5+ and a molecular weight of 377.46 g/mol. Its IUPAC name is 3-(1-hydroxypyridin-1-ium-3-yl)propyl 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate.
| Compound Name | 3-(1-hydroxypyridin-1-ium-3-yl)propyl 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 142038688 |
| Molecular Formula | C20H29N2O5+ |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 3-(1-hydroxypyridin-1-ium-3-yl)propyl 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1C(=O)OCCCc1ccc[n+](O)c1 |
| InChI | InChI=1S/C20H29N2O5/c1-4-20(2,3)17(23)18(24)22-12-6-10-16(22)19(25)27-13-7-9-15-8-5-11-21(26)14-15/h5,8,11,14,16,26H,4,6-7,9-10,12-13H2,1-3H3/q+1 |
| InChIKey | XXJGLSYYKVIZNR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|