C25H31NO3S — CID 10137244
O-(3-naphthalen-1-ylpropyl) 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate (PubChem CID 10137244) has the molecular formula C25H31NO3S and a molecular weight of 425.59 g/mol. Its IUPAC name is O-(3-naphthalen-1-ylpropyl) 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate.
| Compound Name | O-(3-naphthalen-1-ylpropyl) 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate |
|---|---|
| PubChem CID | 10137244 |
| Molecular Formula | C25H31NO3S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | O-(3-naphthalen-1-ylpropyl) 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1C(=S)OCCCc1cccc2ccccc12 |
| InChI | InChI=1S/C25H31NO3S/c1-4-25(2,3)22(27)23(28)26-16-8-15-21(26)24(30)29-17-9-13-19-12-7-11-18-10-5-6-14-20(18)19/h5-7,10-12,14,21H,4,8-9,13,15-17H2,1-3H3 |
| InChIKey | GRTONEWCHWLQOI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|