C22H30ClNO3S — CID 11750598
S-[3-(2-chlorophenyl)propyl] 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carbothioate (PubChem CID 11750598) has the molecular formula C22H30ClNO3S and a molecular weight of 424.01 g/mol. Its IUPAC name is S-[3-(2-chlorophenyl)propyl] 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carbothioate.
| Compound Name | S-[3-(2-chlorophenyl)propyl] 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carbothioate |
|---|---|
| PubChem CID | 11750598 |
| Molecular Formula | C22H30ClNO3S |
| Molecular Weight | 424.01 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | S-[3-(2-chlorophenyl)propyl] 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carbothioate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCCC1C(=O)SCCCc1ccccc1Cl |
| InChI | InChI=1S/C22H30ClNO3S/c1-4-22(2,3)19(25)20(26)24-14-8-7-13-18(24)21(27)28-15-9-11-16-10-5-6-12-17(16)23/h5-6,10,12,18H,4,7-9,11,13-15H2,1-3H3 |
| InChIKey | YERLYPUNDSDLQI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.01 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|