C29H37NO3 — CID 58648553
3,3-dimethyl-1-[(2S)-2-[4-phenyl-2-(2-phenylethyl)butanoyl]pyrrolidin-1-yl]pentane-1,2-dione (PubChem CID 58648553) has the molecular formula C29H37NO3 and a molecular weight of 447.62 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(2S)-2-[4-phenyl-2-(2-phenylethyl)butanoyl]pyrrolidin-1-yl]pentane-1,2-dione.
| Compound Name | 3,3-dimethyl-1-[(2S)-2-[4-phenyl-2-(2-phenylethyl)butanoyl]pyrrolidin-1-yl]pentane-1,2-dione |
|---|---|
| PubChem CID | 58648553 |
| Molecular Formula | C29H37NO3 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | 3,3-dimethyl-1-[(2S)-2-[4-phenyl-2-(2-phenylethyl)butanoyl]pyrrolidin-1-yl]pentane-1,2-dione |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCC[C@H]1C(=O)C(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C29H37NO3/c1-4-29(2,3)27(32)28(33)30-21-11-16-25(30)26(31)24(19-17-22-12-7-5-8-13-22)20-18-23-14-9-6-10-15-23/h5-10,12-15,24-25H,4,11,16-21H2,1-3H3/t25-/m0/s1 |
| InChIKey | OBHDPLFTECIYKR-VWLOTQADSA-N |
| XLogP | 5.43 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|