C21H30F2N2O2 — CID 163737262
1-[2-[difluoro-(3-phenylpropylamino)methyl]pyrrolidin-1-yl]-3,3-dimethylpentane-1,2-dione (PubChem CID 163737262) has the molecular formula C21H30F2N2O2 and a molecular weight of 380.48 g/mol. Its IUPAC name is 1-[2-[difluoro-(3-phenylpropylamino)methyl]pyrrolidin-1-yl]-3,3-dimethylpentane-1,2-dione.
| Compound Name | 1-[2-[difluoro-(3-phenylpropylamino)methyl]pyrrolidin-1-yl]-3,3-dimethylpentane-1,2-dione |
|---|---|
| PubChem CID | 163737262 |
| Molecular Formula | C21H30F2N2O2 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 1-[2-[difluoro-(3-phenylpropylamino)methyl]pyrrolidin-1-yl]-3,3-dimethylpentane-1,2-dione |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1C(F)(F)NCCCc1ccccc1 |
| InChI | InChI=1S/C21H30F2N2O2/c1-4-20(2,3)18(26)19(27)25-15-9-13-17(25)21(22,23)24-14-8-12-16-10-6-5-7-11-16/h5-7,10-11,17,24H,4,8-9,12-15H2,1-3H3 |
| InChIKey | LERNAOIKONBGPR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|