C22H31NO3S — CID 57242116
O-(4-phenylbutyl) (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate (PubChem CID 57242116) has the molecular formula C22H31NO3S and a molecular weight of 389.56 g/mol. Its IUPAC name is O-(4-phenylbutyl) (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate.
| Compound Name | O-(4-phenylbutyl) (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate |
|---|---|
| PubChem CID | 57242116 |
| Molecular Formula | C22H31NO3S |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | O-(4-phenylbutyl) (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCC[C@H]1C(=S)OCCCCc1ccccc1 |
| InChI | InChI=1S/C22H31NO3S/c1-4-22(2,3)19(24)20(25)23-15-10-14-18(23)21(27)26-16-9-8-13-17-11-6-5-7-12-17/h5-7,11-12,18H,4,8-10,13-16H2,1-3H3/t18-/m0/s1 |
| InChIKey | FMOFQWCFTRJJOX-SFHVURJKSA-N |
| XLogP | 4.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|