C27H33NO3S — CID 57319503
O-(2,2-diphenylethyl) (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carbothioate (PubChem CID 57319503) has the molecular formula C27H33NO3S and a molecular weight of 451.63 g/mol. Its IUPAC name is O-(2,2-diphenylethyl) (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carbothioate.
| Compound Name | O-(2,2-diphenylethyl) (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carbothioate |
|---|---|
| PubChem CID | 57319503 |
| Molecular Formula | C27H33NO3S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | O-(2,2-diphenylethyl) (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carbothioate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC[C@H]1C(=S)OCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33NO3S/c1-4-27(2,3)24(29)25(30)28-18-12-11-17-23(28)26(32)31-19-22(20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-10,13-16,22-23H,4,11-12,17-19H2,1-3H3/t23-/m0/s1 |
| InChIKey | XORIPGGPBGIJIA-QHCPKHFHSA-N |
| XLogP | 5.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|