C20H24ClNO6 — CID 141253889
benzyl (2S)-1-(4-carbonochloridoyloxy-3,3-dimethyl-2-oxobutanoyl)piperidine-2-carboxylate (PubChem CID 141253889) has the molecular formula C20H24ClNO6 and a molecular weight of 409.87 g/mol. Its IUPAC name is benzyl (2S)-1-(4-carbonochloridoyloxy-3,3-dimethyl-2-oxobutanoyl)piperidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-(4-carbonochloridoyloxy-3,3-dimethyl-2-oxobutanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 141253889 |
| Molecular Formula | C20H24ClNO6 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | benzyl (2S)-1-(4-carbonochloridoyloxy-3,3-dimethyl-2-oxobutanoyl)piperidine-2-carboxylate |
| SMILES | CC(C)(COC(=O)Cl)C(=O)C(=O)N1CCCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H24ClNO6/c1-20(2,13-28-19(21)26)16(23)17(24)22-11-7-6-10-15(22)18(25)27-12-14-8-4-3-5-9-14/h3-5,8-9,15H,6-7,10-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | UNOZRYGASVDWOH-HNNXBMFYSA-N |
| XLogP | 3.08 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|