C18H17ClN2O3 — CID 95233599
benzyl (2S)-1-(6-chloropyridine-3-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 95233599) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is benzyl (2S)-1-(6-chloropyridine-3-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-(6-chloropyridine-3-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 95233599 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | benzyl (2S)-1-(6-chloropyridine-3-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1CCCN1C(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C18H17ClN2O3/c19-16-9-8-14(11-20-16)17(22)21-10-4-7-15(21)18(23)24-12-13-5-2-1-3-6-13/h1-3,5-6,8-9,11,15H,4,7,10,12H2/t15-/m0/s1 |
| InChIKey | BRMFNMYFPASLBR-HNNXBMFYSA-N |
| XLogP | 3.08 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|