C22H30ClNO3S — CID 54417253
O-propyl 3-(2-chlorophenyl)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carbothioate (PubChem CID 54417253) has the molecular formula C22H30ClNO3S and a molecular weight of 424.01 g/mol. Its IUPAC name is O-propyl 3-(2-chlorophenyl)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carbothioate.
| Compound Name | O-propyl 3-(2-chlorophenyl)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carbothioate |
|---|---|
| PubChem CID | 54417253 |
| Molecular Formula | C22H30ClNO3S |
| Molecular Weight | 424.01 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | O-propyl 3-(2-chlorophenyl)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carbothioate |
| SMILES | CCCOC(=S)C1C(c2ccccc2Cl)CCCN1C(=O)C(=O)C(C)(C)CC |
| InChI | InChI=1S/C22H30ClNO3S/c1-5-14-27-21(28)18-16(15-10-7-8-12-17(15)23)11-9-13-24(18)20(26)19(25)22(3,4)6-2/h7-8,10,12,16,18H,5-6,9,11,13-14H2,1-4H3 |
| InChIKey | VYHPLMUFDRPWDC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.01 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|