C21H25Cl2NO4 — CID 23555947
[(E)-3-(3,4-dichlorophenyl)prop-2-enyl] 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate (PubChem CID 23555947) has the molecular formula C21H25Cl2NO4 and a molecular weight of 426.34 g/mol. Its IUPAC name is [(E)-3-(3,4-dichlorophenyl)prop-2-enyl] 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate.
| Compound Name | [(E)-3-(3,4-dichlorophenyl)prop-2-enyl] 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 23555947 |
| Molecular Formula | C21H25Cl2NO4 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | [(E)-3-(3,4-dichlorophenyl)prop-2-enyl] 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1C(=O)OC/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H25Cl2NO4/c1-4-21(2,3)18(25)19(26)24-11-5-8-17(24)20(27)28-12-6-7-14-9-10-15(22)16(23)13-14/h6-7,9-10,13,17H,4-5,8,11-12H2,1-3H3/b7-6+ |
| InChIKey | BCUHNZVDUINERO-VOTSOKGWSA-N |
| XLogP | 4.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|