C16H27NO4 — CID 86586326
propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate (PubChem CID 86586326) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate.
| Compound Name | propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 86586326 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
| SMILES | CCCOC(=O)[C@@H]1CCCCN1C(=O)C(=O)C(C)(C)CC |
| InChI | InChI=1S/C16H27NO4/c1-5-11-21-15(20)12-9-7-8-10-17(12)14(19)13(18)16(3,4)6-2/h12H,5-11H2,1-4H3/t12-/m0/s1 |
| InChIKey | GTZVYGLYWWKLLR-LBPRGKRZSA-N |
| XLogP | 2.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|