C16H25NO6 — CID 70221795
6-(2-ethoxycarbonylpiperidin-1-yl)-4,4-dimethyl-5,6-dioxohexanoic acid (PubChem CID 70221795) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is 6-(2-ethoxycarbonylpiperidin-1-yl)-4,4-dimethyl-5,6-dioxohexanoic acid.
| Compound Name | 6-(2-ethoxycarbonylpiperidin-1-yl)-4,4-dimethyl-5,6-dioxohexanoic acid |
|---|---|
| PubChem CID | 70221795 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 6-(2-ethoxycarbonylpiperidin-1-yl)-4,4-dimethyl-5,6-dioxohexanoic acid |
| SMILES | CCOC(=O)C1CCCCN1C(=O)C(=O)C(C)(C)CCC(=O)O |
| InChI | InChI=1S/C16H25NO6/c1-4-23-15(22)11-7-5-6-10-17(11)14(21)13(20)16(2,3)9-8-12(18)19/h11H,4-10H2,1-3H3,(H,18,19) |
| InChIKey | YXAGWXCANDTFME-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|