ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate

C13H23NO3 — CID 55005582

IUPACethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate
SMILESCCOC(=O)C1CCCN1C(=O)CC(C)(C)C
InChIInChI=1S/C13H23NO3/c1-5-17-12(16)10-7-6-8-14(10)11(15)9-13(2,3)4/h10H,5-9H2,1-4H3
InChIKeyPWRZVPJXYVEKPS-UHFFFAOYSA-N
MW241.33 g/mol
LogP1.98
Rot. Bonds3

About ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate

ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate (PubChem CID 55005582) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate.

Molecular Properties

Compound Nameethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate
PubChem CID55005582
Molecular FormulaC13H23NO3
Molecular Weight241.33 g/mol
Exact Mass241.17
IUPAC Nameethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate
SMILESCCOC(=O)C1CCCN1C(=O)CC(C)(C)C
InChIInChI=1S/C13H23NO3/c1-5-17-12(16)10-7-6-8-14(10)11(15)9-13(2,3)4/h10H,5-9H2,1-4H3
InChIKeyPWRZVPJXYVEKPS-UHFFFAOYSA-N
XLogP1.98
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.33
LogP ≤ 51.98
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate?
The IUPAC name of ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate (CID 55005582) is ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate.
What is the SMILES notation for ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate?
The canonical SMILES for ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate is CCOC(=O)C1CCCN1C(=O)CC(C)(C)C.
What is the InChIKey of ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate?
The InChIKey is PWRZVPJXYVEKPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO3/c1-5-17-12(16)10-7-6-8-14(10)11(15)9-13(2,3)4/h10H,5-9H2,1-4H3.
What are the key properties of ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate?
ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate has a molecular weight of 241.33 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 55005582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).