C13H23NO3 — CID 55005582
ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate (PubChem CID 55005582) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55005582 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | ethyl 1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1C(=O)CC(C)(C)C |
| InChI | InChI=1S/C13H23NO3/c1-5-17-12(16)10-7-6-8-14(10)11(15)9-13(2,3)4/h10H,5-9H2,1-4H3 |
| InChIKey | PWRZVPJXYVEKPS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |