C11H12F7NO3 — CID 86238608
ethyl 1-(2,2,3,3,4,4,4-heptafluorobutanoyl)pyrrolidine-2-carboxylate (PubChem CID 86238608) has the molecular formula C11H12F7NO3 and a molecular weight of 339.21 g/mol. Its IUPAC name is ethyl 1-(2,2,3,3,4,4,4-heptafluorobutanoyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-(2,2,3,3,4,4,4-heptafluorobutanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 86238608 |
| Molecular Formula | C11H12F7NO3 |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | ethyl 1-(2,2,3,3,4,4,4-heptafluorobutanoyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H12F7NO3/c1-2-22-7(20)6-4-3-5-19(6)8(21)9(12,13)10(14,15)11(16,17)18/h6H,2-5H2,1H3 |
| InChIKey | FDCZUNMXHDNQHK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|