C22H33F5N2O4 — CID 91735083
nonyl 1-[1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 91735083) has the molecular formula C22H33F5N2O4 and a molecular weight of 484.51 g/mol. Its IUPAC name is nonyl 1-[1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | nonyl 1-[1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91735083 |
| Molecular Formula | C22H33F5N2O4 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | nonyl 1-[1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCCOC(=O)C1CCCN1C(=O)C1CCCN1C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H33F5N2O4/c1-2-3-4-5-6-7-8-15-33-19(31)17-12-10-13-28(17)18(30)16-11-9-14-29(16)20(32)21(23,24)22(25,26)27/h16-17H,2-15H2,1H3 |
| InChIKey | PMKQUSYUEGPHJM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|