C18H25F5N2O4 — CID 91735081
pentyl 1-[1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 91735081) has the molecular formula C18H25F5N2O4 and a molecular weight of 428.40 g/mol. Its IUPAC name is pentyl 1-[1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | pentyl 1-[1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91735081 |
| Molecular Formula | C18H25F5N2O4 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | pentyl 1-[1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCOC(=O)C1CCCN1C(=O)C1CCCN1C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H25F5N2O4/c1-2-3-4-11-29-15(27)13-8-6-9-24(13)14(26)12-7-5-10-25(12)16(28)17(19,20)18(21,22)23/h12-13H,2-11H2,1H3 |
| InChIKey | YZGRCSHCZHERBZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|