C10H9F8NO3 — CID 91724240
2,2,3,3,3-pentafluoropropyl 1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxylate (PubChem CID 91724240) has the molecular formula C10H9F8NO3 and a molecular weight of 343.17 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxylate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91724240 |
| Molecular Formula | C10H9F8NO3 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCC(F)(F)C(F)(F)F)C1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H9F8NO3/c11-8(12,10(16,17)18)4-22-6(20)5-2-1-3-19(5)7(21)9(13,14)15/h5H,1-4H2 |
| InChIKey | WUMSDKKXNIAXOC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|