About butan-2-yl 1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate
butan-2-yl 1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate (PubChem CID 601862) has the molecular formula C12H18F3NO3
and a molecular weight of 281.27 g/mol. Its IUPAC name is butan-2-yl 1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate.
Analyze butan-2-yl 1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate?
The IUPAC name of butan-2-yl 1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate (CID 601862) is butan-2-yl 1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate.
What is the SMILES notation for butan-2-yl 1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate?
The canonical SMILES for butan-2-yl 1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate is CCC(C)OC(=O)C1CCCCN1C(=O)C(F)(F)F.
What is the InChIKey of butan-2-yl 1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate?
The InChIKey is WPEYTXDPQFFBSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3NO3/c1-3-8(2)19-10(17)9-6-4-5-7-16(9)11(18)12(13,14)15/h8-9H,3-7H2,1-2H3.
What are the key properties of butan-2-yl 1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate?
butan-2-yl 1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate has a molecular weight of 281.27 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate is sourced from PubChem (CID 601862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).