C11H18F3NO — CID 162620815
1-(2-butylpiperidin-1-yl)-2,2,2-trifluoroethanone (PubChem CID 162620815) has the molecular formula C11H18F3NO and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-(2-butylpiperidin-1-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(2-butylpiperidin-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 162620815 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1-(2-butylpiperidin-1-yl)-2,2,2-trifluoroethanone |
| SMILES | CCCCC1CCCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H18F3NO/c1-2-3-6-9-7-4-5-8-15(9)10(16)11(12,13)14/h9H,2-8H2,1H3 |
| InChIKey | FOSGNBKZMGVHNE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |