2-nonylpiperidine-1-carboxylic acid

C15H29NO2 — CID 69469776

IUPAC2-nonylpiperidine-1-carboxylic acid
SMILESCCCCCCCCCC1CCCCN1C(=O)O
InChIInChI=1S/C15H29NO2/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-16(14)15(17)18/h14H,2-13H2,1H3,(H,17,18)
InChIKeyCNBICZLRFQQWFB-UHFFFAOYSA-N
MW255.40 g/mol
LogP4.66
Rot. Bonds8

About 2-nonylpiperidine-1-carboxylic acid

2-nonylpiperidine-1-carboxylic acid (PubChem CID 69469776) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 2-nonylpiperidine-1-carboxylic acid.

Molecular Properties

Compound Name2-nonylpiperidine-1-carboxylic acid
PubChem CID69469776
Molecular FormulaC15H29NO2
Molecular Weight255.40 g/mol
Exact Mass255.22
IUPAC Name2-nonylpiperidine-1-carboxylic acid
SMILESCCCCCCCCCC1CCCCN1C(=O)O
InChIInChI=1S/C15H29NO2/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-16(14)15(17)18/h14H,2-13H2,1H3,(H,17,18)
InChIKeyCNBICZLRFQQWFB-UHFFFAOYSA-N
XLogP4.66
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds8
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.40
LogP ≤ 54.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-nonylpiperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-nonylpiperidine-1-carboxylic acid?
The IUPAC name of 2-nonylpiperidine-1-carboxylic acid (CID 69469776) is 2-nonylpiperidine-1-carboxylic acid.
What is the SMILES notation for 2-nonylpiperidine-1-carboxylic acid?
The canonical SMILES for 2-nonylpiperidine-1-carboxylic acid is CCCCCCCCCC1CCCCN1C(=O)O.
What is the InChIKey of 2-nonylpiperidine-1-carboxylic acid?
The InChIKey is CNBICZLRFQQWFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-16(14)15(17)18/h14H,2-13H2,1H3,(H,17,18).
What are the key properties of 2-nonylpiperidine-1-carboxylic acid?
2-nonylpiperidine-1-carboxylic acid has a molecular weight of 255.40 g/mol, XLogP of 4.66, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nonylpiperidine-1-carboxylic acid is sourced from PubChem (CID 69469776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).