C8H11F3NO3Tl — CID 142455278
[(2R)-1-(2,2,2-trifluoroacetyl)piperidin-2-yl]methylperoxythallium (PubChem CID 142455278) has the molecular formula C8H11F3NO3Tl and a molecular weight of 430.56 g/mol. Its IUPAC name is [(2R)-1-(2,2,2-trifluoroacetyl)piperidin-2-yl]methylperoxythallium.
| Compound Name | [(2R)-1-(2,2,2-trifluoroacetyl)piperidin-2-yl]methylperoxythallium |
|---|---|
| PubChem CID | 142455278 |
| Molecular Formula | C8H11F3NO3Tl |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | [(2R)-1-(2,2,2-trifluoroacetyl)piperidin-2-yl]methylperoxythallium |
| SMILES | O=C(N1CCCC[C@@H]1COO[Tl])C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO3.Tl/c9-8(10,11)7(13)12-4-2-1-3-6(12)5-15-14;/h6,14H,1-5H2;/q;+1/p-1/t6-;/m1./s1 |
| InChIKey | PWSQWVRGMIJGOJ-FYZOBXCZSA-M |
| XLogP | 0.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|